About (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene
(1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene (PubChem CID 10942492) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene |
| PubChem CID | 10942492 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene |
| SMILES | CC(C)=C1[C@@H]2CC[C@H]1N=N2 |
| InChI | InChI=1S/C8H12N2/c1-5(2)8-6-3-4-7(8)10-9-6/h6-7H,3-4H2,1-2H3/t6-,7+ |
| InChIKey | KUJNXDNXJVMMFN-KNVOCYPGSA-N |
| XLogP | 2.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene?
The IUPAC name of (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene (CID 10942492) is (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene?
The canonical SMILES for (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene is CC(C)=C1[C@@H]2CC[C@H]1N=N2.
What is the InChIKey of (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene?
The InChIKey is KUJNXDNXJVMMFN-KNVOCYPGSA-N. The full InChI is InChI=1S/C8H12N2/c1-5(2)8-6-3-4-7(8)10-9-6/h6-7H,3-4H2,1-2H3/t6-,7+.
What are the key properties of (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene?
(1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene has a molecular weight of 136.20 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4S)-7-propan-2-ylidene-2,3-diazabicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 10942492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).