About octa-1,7-diene-4,5-diol
octa-1,7-diene-4,5-diol (PubChem CID 10942542) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is octa-1,7-diene-4,5-diol.
Molecular Properties
| Compound Name | octa-1,7-diene-4,5-diol |
| PubChem CID | 10942542 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | octa-1,7-diene-4,5-diol |
| SMILES | C=CCC(O)C(O)CC=C |
| InChI | InChI=1S/C8H14O2/c1-3-5-7(9)8(10)6-4-2/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | WNGQPXSRMCTUJF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octa-1,7-diene-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octa-1,7-diene-4,5-diol?
The IUPAC name of octa-1,7-diene-4,5-diol (CID 10942542) is octa-1,7-diene-4,5-diol.
What is the SMILES notation for octa-1,7-diene-4,5-diol?
The canonical SMILES for octa-1,7-diene-4,5-diol is C=CCC(O)C(O)CC=C.
What is the InChIKey of octa-1,7-diene-4,5-diol?
The InChIKey is WNGQPXSRMCTUJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-5-7(9)8(10)6-4-2/h3-4,7-10H,1-2,5-6H2.
What are the key properties of octa-1,7-diene-4,5-diol?
octa-1,7-diene-4,5-diol has a molecular weight of 142.20 g/mol, XLogP of 0.86, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octa-1,7-diene-4,5-diol is sourced from PubChem (CID 10942542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).