About [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride
[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride (PubChem CID 10942611) has the molecular formula C6H12ClNO
and a molecular weight of 149.62 g/mol. Its IUPAC name is [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride.
Molecular Properties
| Compound Name | [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride |
| PubChem CID | 10942611 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride |
| SMILES | [Cl-].[NH3+][C@H]1C=C[C@@H](CO)C1 |
| InChI | InChI=1S/C6H11NO.ClH/c7-6-2-1-5(3-6)4-8;/h1-2,5-6,8H,3-4,7H2;1H/t5-,6+;/m1./s1 |
| InChIKey | DFJSXBUVSKWALM-IBTYICNHSA-N |
| XLogP | -3.83 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride?
The IUPAC name of [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride (CID 10942611) is [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride.
What is the SMILES notation for [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride?
The canonical SMILES for [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride is [Cl-].[NH3+][C@H]1C=C[C@@H](CO)C1.
What is the InChIKey of [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride?
The InChIKey is DFJSXBUVSKWALM-IBTYICNHSA-N. The full InChI is InChI=1S/C6H11NO.ClH/c7-6-2-1-5(3-6)4-8;/h1-2,5-6,8H,3-4,7H2;1H/t5-,6+;/m1./s1.
What are the key properties of [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride?
[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride has a molecular weight of 149.62 g/mol, XLogP of -3.83, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]azanium chloride is sourced from PubChem (CID 10942611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).