About 1-cyclohexylimidazole
1-cyclohexylimidazole (PubChem CID 10942619) has the molecular formula C9H14N2
and a molecular weight of 150.23 g/mol. Its IUPAC name is 1-cyclohexylimidazole.
Molecular Properties
| Compound Name | 1-cyclohexylimidazole |
| PubChem CID | 10942619 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1-cyclohexylimidazole |
| SMILES | c1cn(C2CCCCC2)cn1 |
| InChI | InChI=1S/C9H14N2/c1-2-4-9(5-3-1)11-7-6-10-8-11/h6-9H,1-5H2 |
| InChIKey | VGZINEPOBWTUEH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylimidazole?
The IUPAC name of 1-cyclohexylimidazole (CID 10942619) is 1-cyclohexylimidazole.
What is the SMILES notation for 1-cyclohexylimidazole?
The canonical SMILES for 1-cyclohexylimidazole is c1cn(C2CCCCC2)cn1.
What is the InChIKey of 1-cyclohexylimidazole?
The InChIKey is VGZINEPOBWTUEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-2-4-9(5-3-1)11-7-6-10-8-11/h6-9H,1-5H2.
What are the key properties of 1-cyclohexylimidazole?
1-cyclohexylimidazole has a molecular weight of 150.23 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylimidazole is sourced from PubChem (CID 10942619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).