About 1-cyclohexylbuta-2,3-dien-1-ol
1-cyclohexylbuta-2,3-dien-1-ol (PubChem CID 10942646) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-cyclohexylbuta-2,3-dien-1-ol.
Molecular Properties
| Compound Name | 1-cyclohexylbuta-2,3-dien-1-ol |
| PubChem CID | 10942646 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 1-cyclohexylbuta-2,3-dien-1-ol |
| SMILES | C=C=CC(O)C1CCCCC1 |
| InChI | InChI=1S/C10H16O/c1-2-6-10(11)9-7-4-3-5-8-9/h6,9-11H,1,3-5,7-8H2 |
| InChIKey | VWIZIXVRCHGPIP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexylbuta-2,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylbuta-2,3-dien-1-ol?
The IUPAC name of 1-cyclohexylbuta-2,3-dien-1-ol (CID 10942646) is 1-cyclohexylbuta-2,3-dien-1-ol.
What is the SMILES notation for 1-cyclohexylbuta-2,3-dien-1-ol?
The canonical SMILES for 1-cyclohexylbuta-2,3-dien-1-ol is C=C=CC(O)C1CCCCC1.
What is the InChIKey of 1-cyclohexylbuta-2,3-dien-1-ol?
The InChIKey is VWIZIXVRCHGPIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-2-6-10(11)9-7-4-3-5-8-9/h6,9-11H,1,3-5,7-8H2.
What are the key properties of 1-cyclohexylbuta-2,3-dien-1-ol?
1-cyclohexylbuta-2,3-dien-1-ol has a molecular weight of 152.24 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylbuta-2,3-dien-1-ol is sourced from PubChem (CID 10942646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).