About 1H-inden-2-ylboronic acid
1H-inden-2-ylboronic acid (PubChem CID 10942739) has the molecular formula C9H9BO2
and a molecular weight of 159.98 g/mol. Its IUPAC name is 1H-inden-2-ylboronic acid.
Molecular Properties
| Compound Name | 1H-inden-2-ylboronic acid |
| PubChem CID | 10942739 |
| Molecular Formula | C9H9BO2 |
| Molecular Weight | 159.98 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 1H-inden-2-ylboronic acid |
| SMILES | OB(O)C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C9H9BO2/c11-10(12)9-5-7-3-1-2-4-8(7)6-9/h1-5,11-12H,6H2 |
| InChIKey | VBMIZCKXRRAXBK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.98 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-2-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-2-ylboronic acid?
The IUPAC name of 1H-inden-2-ylboronic acid (CID 10942739) is 1H-inden-2-ylboronic acid.
What is the SMILES notation for 1H-inden-2-ylboronic acid?
The canonical SMILES for 1H-inden-2-ylboronic acid is OB(O)C1=Cc2ccccc2C1.
What is the InChIKey of 1H-inden-2-ylboronic acid?
The InChIKey is VBMIZCKXRRAXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BO2/c11-10(12)9-5-7-3-1-2-4-8(7)6-9/h1-5,11-12H,6H2.
What are the key properties of 1H-inden-2-ylboronic acid?
1H-inden-2-ylboronic acid has a molecular weight of 159.98 g/mol, XLogP of 0.64, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-2-ylboronic acid is sourced from PubChem (CID 10942739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).