C24H29N5O — CID 109427575
N-ethyl-4-phenoxy-N'-[(5-phenyl-1H-imidazol-2-yl)methyl]piperidine-1-carboximidamide (PubChem CID 109427575) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is N-ethyl-4-phenoxy-N'-[(5-phenyl-1H-imidazol-2-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-phenoxy-N'-[(5-phenyl-1H-imidazol-2-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109427575 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | N-ethyl-4-phenoxy-N'-[(5-phenyl-1H-imidazol-2-yl)methyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ncc(-c2ccccc2)[nH]1)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N5O/c1-2-25-24(27-18-23-26-17-22(28-23)19-9-5-3-6-10-19)29-15-13-21(14-16-29)30-20-11-7-4-8-12-20/h3-12,17,21H,2,13-16,18H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | ODTJSQXRIWSREC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|