About O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate
O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate (PubChem CID 10942810) has the molecular formula C9H10OS
and a molecular weight of 166.24 g/mol. Its IUPAC name is O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate.
Molecular Properties
| Compound Name | O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate |
| PubChem CID | 10942810 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate |
| SMILES | COC(=S)C1=CC=CC12CC2 |
| InChI | InChI=1S/C9H10OS/c1-10-8(11)7-3-2-4-9(7)5-6-9/h2-4H,5-6H2,1H3 |
| InChIKey | FNYQGOOIVFAXNJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate?
The IUPAC name of O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate (CID 10942810) is O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate.
What is the SMILES notation for O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate?
The canonical SMILES for O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate is COC(=S)C1=CC=CC12CC2.
What is the InChIKey of O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate?
The InChIKey is FNYQGOOIVFAXNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OS/c1-10-8(11)7-3-2-4-9(7)5-6-9/h2-4H,5-6H2,1H3.
What are the key properties of O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate?
O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate has a molecular weight of 166.24 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl spiro[2.4]hepta-4,6-diene-7-carbothioate is sourced from PubChem (CID 10942810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).