About 2-phenylsulfanylpropanal
2-phenylsulfanylpropanal (PubChem CID 10942811) has the molecular formula C9H10OS
and a molecular weight of 166.25 g/mol. Its IUPAC name is 2-phenylsulfanylpropanal.
Molecular Properties
| Compound Name | 2-phenylsulfanylpropanal |
| PubChem CID | 10942811 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 2-phenylsulfanylpropanal |
| SMILES | CC(C=O)Sc1ccccc1 |
| InChI | InChI=1S/C9H10OS/c1-8(7-10)11-9-5-3-2-4-6-9/h2-8H,1H3 |
| InChIKey | YQORRZVFWPFOOV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylsulfanylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylpropanal?
The IUPAC name of 2-phenylsulfanylpropanal (CID 10942811) is 2-phenylsulfanylpropanal.
What is the SMILES notation for 2-phenylsulfanylpropanal?
The canonical SMILES for 2-phenylsulfanylpropanal is CC(C=O)Sc1ccccc1.
What is the InChIKey of 2-phenylsulfanylpropanal?
The InChIKey is YQORRZVFWPFOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OS/c1-8(7-10)11-9-5-3-2-4-6-9/h2-8H,1H3.
What are the key properties of 2-phenylsulfanylpropanal?
2-phenylsulfanylpropanal has a molecular weight of 166.25 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylpropanal is sourced from PubChem (CID 10942811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).