C19H34N4O2 — CID 109428613
2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[(1-propoxycyclohexyl)methyl]guanidine (PubChem CID 109428613) has the molecular formula C19H34N4O2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[(1-propoxycyclohexyl)methyl]guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[(1-propoxycyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 109428613 |
| Molecular Formula | C19H34N4O2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[(1-propoxycyclohexyl)methyl]guanidine |
| SMILES | CCCOC1(CN/C(=N/Cc2nc(C)c(C)o2)NCC)CCCCC1 |
| InChI | InChI=1S/C19H34N4O2/c1-5-12-24-19(10-8-7-9-11-19)14-22-18(20-6-2)21-13-17-23-15(3)16(4)25-17/h5-14H2,1-4H3,(H2,20,21,22) |
| InChIKey | UURLMYMBFZPQIJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|