C21H31N5O — CID 109428893
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]guanidine (PubChem CID 109428893) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109428893 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(N2CCC(C)CC2)cc1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C21H31N5O/c1-15-9-11-26(12-10-15)19-7-5-18(6-8-19)13-23-21(22-4)24-14-20-25-16(2)17(3)27-20/h5-8,15H,9-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | QHBXCRXKIIRASY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|