C20H25FN6O — CID 109430057
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]guanidine (PubChem CID 109430057) has the molecular formula C20H25FN6O and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109430057 |
| Molecular Formula | C20H25FN6O |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)c(F)c1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C20H25FN6O/c1-5-22-20(25-12-19-26-13(2)14(3)28-19)24-11-16-6-7-18(17(21)10-16)27-9-8-23-15(27)4/h6-10H,5,11-12H2,1-4H3,(H2,22,24,25) |
| InChIKey | LKZKZMYYIWNJGE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|