C20H30IN5O2 — CID 109430548
N-[3-[[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide;hydroiodide (PubChem CID 109430548) has the molecular formula C20H30IN5O2 and a molecular weight of 499.40 g/mol. Its IUPAC name is N-[3-[[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide;hydroiodide.
| Compound Name | N-[3-[[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide;hydroiodide |
|---|---|
| PubChem CID | 109430548 |
| Molecular Formula | C20H30IN5O2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-[3-[[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide;hydroiodide |
| SMILES | CCCC(=O)Nc1cccc(C/N=C(\NCC)NCc2nc(C)c(C)o2)c1.I |
| InChI | InChI=1S/C20H29N5O2.HI/c1-5-8-18(26)25-17-10-7-9-16(11-17)12-22-20(21-6-2)23-13-19-24-14(3)15(4)27-19;/h7,9-11H,5-6,8,12-13H2,1-4H3,(H,25,26)(H2,21,22,23);1H |
| InChIKey | DMSIKVPRIJQPGU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|