About Cyclobutanone, 3-octyl-
Cyclobutanone, 3-octyl- (PubChem CID 10943105) has the molecular formula C12H22O
and a molecular weight of 182.30 g/mol. Its IUPAC name is 3-octylcyclobutan-1-one.
Molecular Properties
| Compound Name | Cyclobutanone, 3-octyl- |
| PubChem CID | 10943105 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.30 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 3-octylcyclobutan-1-one |
| SMILES | CCCCCCCCC1CC(=O)C1 |
| InChI | InChI=1S/C12H22O/c1-2-3-4-5-6-7-8-11-9-12(13)10-11/h11H,2-10H2,1H3 |
| InChIKey | DCXUUFRIRJVXJX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | 143 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Cyclobutanone, 3-octyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cyclobutanone, 3-octyl-?
The IUPAC name of Cyclobutanone, 3-octyl- (CID 10943105) is 3-octylcyclobutan-1-one.
What is the SMILES notation for Cyclobutanone, 3-octyl-?
The canonical SMILES for Cyclobutanone, 3-octyl- is CCCCCCCCC1CC(=O)C1.
What is the InChIKey of Cyclobutanone, 3-octyl-?
The InChIKey is DCXUUFRIRJVXJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O/c1-2-3-4-5-6-7-8-11-9-12(13)10-11/h11H,2-10H2,1H3.
What are the key properties of Cyclobutanone, 3-octyl-?
Cyclobutanone, 3-octyl- has a molecular weight of 182.30 g/mol, XLogP of 4.30, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Cyclobutanone, 3-octyl- is sourced from PubChem (CID 10943105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).