About 7,8-difluoro-3-methyl-2H-1,4-benzoxazine
7,8-difluoro-3-methyl-2H-1,4-benzoxazine (PubChem CID 10943117) has the molecular formula C9H7F2NO
and a molecular weight of 183.16 g/mol. Its IUPAC name is 7,8-difluoro-3-methyl-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 7,8-difluoro-3-methyl-2H-1,4-benzoxazine |
| PubChem CID | 10943117 |
| Molecular Formula | C9H7F2NO |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 7,8-difluoro-3-methyl-2H-1,4-benzoxazine |
| SMILES | CC1=Nc2ccc(F)c(F)c2OC1 |
| InChI | InChI=1S/C9H7F2NO/c1-5-4-13-9-7(12-5)3-2-6(10)8(9)11/h2-3H,4H2,1H3 |
| InChIKey | BLQUEQUJBDELIP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-difluoro-3-methyl-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-difluoro-3-methyl-2H-1,4-benzoxazine?
The IUPAC name of 7,8-difluoro-3-methyl-2H-1,4-benzoxazine (CID 10943117) is 7,8-difluoro-3-methyl-2H-1,4-benzoxazine.
What is the SMILES notation for 7,8-difluoro-3-methyl-2H-1,4-benzoxazine?
The canonical SMILES for 7,8-difluoro-3-methyl-2H-1,4-benzoxazine is CC1=Nc2ccc(F)c(F)c2OC1.
What is the InChIKey of 7,8-difluoro-3-methyl-2H-1,4-benzoxazine?
The InChIKey is BLQUEQUJBDELIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F2NO/c1-5-4-13-9-7(12-5)3-2-6(10)8(9)11/h2-3H,4H2,1H3.
What are the key properties of 7,8-difluoro-3-methyl-2H-1,4-benzoxazine?
7,8-difluoro-3-methyl-2H-1,4-benzoxazine has a molecular weight of 183.16 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-difluoro-3-methyl-2H-1,4-benzoxazine is sourced from PubChem (CID 10943117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).