C18H27N5OS — CID 109431607
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine (PubChem CID 109431607) has the molecular formula C18H27N5OS and a molecular weight of 361.52 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109431607 |
| Molecular Formula | C18H27N5OS |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCCN1CCc2sccc2C1 |
| InChI | InChI=1S/C18H27N5OS/c1-4-19-18(21-11-17-22-13(2)14(3)24-17)20-7-9-23-8-5-16-15(12-23)6-10-25-16/h6,10H,4-5,7-9,11-12H2,1-3H3,(H2,19,20,21) |
| InChIKey | RCNCOBCNLAKXSX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|