C20H31IN4O2 — CID 109431730
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 109431730) has the molecular formula C20H31IN4O2 and a molecular weight of 486.40 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109431730 |
| Molecular Formula | C20H31IN4O2 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(COC(C)(C)C)c1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C20H30N4O2.HI/c1-14-15(2)26-18(24-14)12-23-19(21-6)22-11-16-8-7-9-17(10-16)13-25-20(3,4)5;/h7-10H,11-13H2,1-6H3,(H2,21,22,23);1H |
| InChIKey | BVXJPNMGSDMXSX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|