About (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol
(2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol (PubChem CID 10943201) has the molecular formula C10H22OSi
and a molecular weight of 186.37 g/mol. Its IUPAC name is (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol.
Molecular Properties
| Compound Name | (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol |
| PubChem CID | 10943201 |
| Molecular Formula | C10H22OSi |
| Molecular Weight | 186.37 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol |
| SMILES | C=C(C)[C@@H]([C@H](C)CO)[Si](C)(C)C |
| InChI | InChI=1S/C10H22OSi/c1-8(2)10(9(3)7-11)12(4,5)6/h9-11H,1,7H2,2-6H3/t9-,10+/m1/s1 |
| InChIKey | HLGDPULUQSGTAP-ZJUUUORDSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol?
The IUPAC name of (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol (CID 10943201) is (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol.
What is the SMILES notation for (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol?
The canonical SMILES for (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol is C=C(C)[C@@H]([C@H](C)CO)[Si](C)(C)C.
What is the InChIKey of (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol?
The InChIKey is HLGDPULUQSGTAP-ZJUUUORDSA-N. The full InChI is InChI=1S/C10H22OSi/c1-8(2)10(9(3)7-11)12(4,5)6/h9-11H,1,7H2,2-6H3/t9-,10+/m1/s1.
What are the key properties of (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol?
(2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol has a molecular weight of 186.37 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2,4-dimethyl-3-trimethylsilylpent-4-en-1-ol is sourced from PubChem (CID 10943201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).