About naphthalen-1-ylmethyl thiocyanate
naphthalen-1-ylmethyl thiocyanate (PubChem CID 10943491) has the molecular formula C12H9NS
and a molecular weight of 199.28 g/mol. Its IUPAC name is naphthalen-1-ylmethyl thiocyanate.
Molecular Properties
| Compound Name | naphthalen-1-ylmethyl thiocyanate |
| PubChem CID | 10943491 |
| Molecular Formula | C12H9NS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | naphthalen-1-ylmethyl thiocyanate |
| SMILES | N#CSCc1cccc2ccccc12 |
| InChI | InChI=1S/C12H9NS/c13-9-14-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8H2 |
| InChIKey | MZOWRHBFWYFSLL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-ylmethyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylmethyl thiocyanate?
The IUPAC name of naphthalen-1-ylmethyl thiocyanate (CID 10943491) is naphthalen-1-ylmethyl thiocyanate.
What is the SMILES notation for naphthalen-1-ylmethyl thiocyanate?
The canonical SMILES for naphthalen-1-ylmethyl thiocyanate is N#CSCc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylmethyl thiocyanate?
The InChIKey is MZOWRHBFWYFSLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS/c13-9-14-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8H2.
What are the key properties of naphthalen-1-ylmethyl thiocyanate?
naphthalen-1-ylmethyl thiocyanate has a molecular weight of 199.28 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylmethyl thiocyanate is sourced from PubChem (CID 10943491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).