C9H12O5 — CID 10943498
methyl 2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-3-carboxylate (PubChem CID 10943498) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is methyl 2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-3-carboxylate.
| Compound Name | methyl 2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-3-carboxylate |
|---|---|
| PubChem CID | 10943498 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | methyl 2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-3-carboxylate |
| SMILES | COC(=O)C1C(=O)OC2OCCCC21 |
| InChI | InChI=1S/C9H12O5/c1-12-7(10)6-5-3-2-4-13-9(5)14-8(6)11/h5-6,9H,2-4H2,1H3 |
| InChIKey | JWVSREMUEHYJTP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|