C13H18O2 — CID 10943654
7-ethynyl-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 10943654) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 7-ethynyl-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene.
| Compound Name | 7-ethynyl-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 10943654 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 7-ethynyl-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | C#CC1=C(C)CCC2(OCCO2)C1(C)C |
| InChI | InChI=1S/C13H18O2/c1-5-11-10(2)6-7-13(12(11,3)4)14-8-9-15-13/h1H,6-9H2,2-4H3 |
| InChIKey | QWBOLLCISYAWCK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|