C15H27F3N4O2S — CID 109437521
2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 109437521) has the molecular formula C15H27F3N4O2S and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 109437521 |
| Molecular Formula | C15H27F3N4O2S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC(=O)N(C)CC(F)(F)F)C1 |
| InChI | InChI=1S/C15H27F3N4O2S/c1-4-25(24)12-7-5-6-11(8-12)21-14(19-2)20-9-13(23)22(3)10-15(16,17)18/h11-12H,4-10H2,1-3H3,(H2,19,20,21) |
| InChIKey | SQJOHDFGHFPOKO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|