C16H30F3IN4O2S — CID 109438562
2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 109438562) has the molecular formula C16H30F3IN4O2S and a molecular weight of 526.41 g/mol. Its IUPAC name is 2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 109438562 |
| Molecular Formula | C16H30F3IN4O2S |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | 2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C16H29F3N4O2S.HI/c1-4-20-15(21-10-14(24)23(3)11-16(17,18)19)22-12-7-6-8-13(9-12)26(25)5-2;/h12-13H,4-11H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | HYZCUOIZJWZZME-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|