C23H38N4O2S — CID 109438697
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 109438697) has the molecular formula C23H38N4O2S and a molecular weight of 434.65 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109438697 |
| Molecular Formula | C23H38N4O2S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(c2cccc(OC)c2)C1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C23H38N4O2S/c1-4-24-23(26-19-8-6-11-22(14-19)30(28)5-2)25-16-18-12-13-27(17-18)20-9-7-10-21(15-20)29-3/h7,9-10,15,18-19,22H,4-6,8,11-14,16-17H2,1-3H3,(H2,24,25,26) |
| InChIKey | NBGNXBJLPQEDOD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|