C24H35IN4O2S — CID 109438782
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109438782) has the molecular formula C24H35IN4O2S and a molecular weight of 570.54 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109438782 |
| Molecular Formula | C24H35IN4O2S |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCc2ccccn2)c1)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C24H34N4O2S.HI/c1-3-25-24(28-20-11-8-13-23(16-20)31(29)4-2)27-17-19-9-7-12-22(15-19)30-18-21-10-5-6-14-26-21;/h5-7,9-10,12,14-15,20,23H,3-4,8,11,13,16-18H2,1-2H3,(H2,25,27,28);1H |
| InChIKey | MUIPPXFQNPKNBK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|