C19H36N4O2S2 — CID 109439679
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine (PubChem CID 109439679) has the molecular formula C19H36N4O2S2 and a molecular weight of 416.66 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109439679 |
| Molecular Formula | C19H36N4O2S2 |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC2(N3CCOCC3)CCSC2)C1 |
| InChI | InChI=1S/C19H36N4O2S2/c1-3-27(24)17-6-4-5-16(13-17)22-18(20-2)21-14-19(7-12-26-15-19)23-8-10-25-11-9-23/h16-17H,3-15H2,1-2H3,(H2,20,21,22) |
| InChIKey | FTDDBIBWTBPMLI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|