About ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate
ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate (PubChem CID 10944080) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate |
| PubChem CID | 10944080 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO3/c1-3-16-12(15)13-9(2)11(14)10-7-5-4-6-8-10/h4-9,11,14H,3H2,1-2H3,(H,13,15)/t9-,11-/m0/s1 |
| InChIKey | HMQGMWCUTUABCN-ONGXEEELSA-N |
| XLogP | 1.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate?
The IUPAC name of ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate (CID 10944080) is ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate.
What is the SMILES notation for ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate?
The canonical SMILES for ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate is CCOC(=O)N[C@@H](C)[C@H](O)c1ccccc1.
What is the InChIKey of ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate?
The InChIKey is HMQGMWCUTUABCN-ONGXEEELSA-N. The full InChI is InChI=1S/C12H17NO3/c1-3-16-12(15)13-9(2)11(14)10-7-5-4-6-8-10/h4-9,11,14H,3H2,1-2H3,(H,13,15)/t9-,11-/m0/s1.
What are the key properties of ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate?
ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate has a molecular weight of 223.27 g/mol, XLogP of 1.85, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]carbamate is sourced from PubChem (CID 10944080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).