C15H15NO — CID 10944128
(3E,5E,7E,9E)-10-pyridin-3-yldeca-3,5,7,9-tetraen-2-one (PubChem CID 10944128) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is (3E,5E,7E,9E)-10-pyridin-3-yldeca-3,5,7,9-tetraen-2-one.
| Compound Name | (3E,5E,7E,9E)-10-pyridin-3-yldeca-3,5,7,9-tetraen-2-one |
|---|---|
| PubChem CID | 10944128 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (3E,5E,7E,9E)-10-pyridin-3-yldeca-3,5,7,9-tetraen-2-one |
| SMILES | CC(=O)/C=C/C=C/C=C/C=C/c1cccnc1 |
| InChI | InChI=1S/C15H15NO/c1-14(17)9-6-4-2-3-5-7-10-15-11-8-12-16-13-15/h2-13H,1H3/b4-2+,5-3+,9-6+,10-7+ |
| InChIKey | MJNYHZWCFFQCRW-ZUFLRRBNSA-N |
| XLogP | 3.35 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|