About 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione
2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione (PubChem CID 10944161) has the molecular formula C10H18O2Si2
and a molecular weight of 226.42 g/mol. Its IUPAC name is 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione.
Molecular Properties
| Compound Name | 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione |
| PubChem CID | 10944161 |
| Molecular Formula | C10H18O2Si2 |
| Molecular Weight | 226.42 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione |
| SMILES | C[Si](C)(C)C(=C=O)C(=C=O)[Si](C)(C)C |
| InChI | InChI=1S/C10H18O2Si2/c1-13(2,3)9(7-11)10(8-12)14(4,5)6/h1-6H3 |
| InChIKey | HCSIDQIGMXXMBO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione?
The IUPAC name of 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione (CID 10944161) is 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione.
What is the SMILES notation for 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione?
The canonical SMILES for 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione is C[Si](C)(C)C(=C=O)C(=C=O)[Si](C)(C)C.
What is the InChIKey of 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione?
The InChIKey is HCSIDQIGMXXMBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2Si2/c1-13(2,3)9(7-11)10(8-12)14(4,5)6/h1-6H3.
What are the key properties of 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione?
2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione has a molecular weight of 226.42 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione is sourced from PubChem (CID 10944161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).