C12H20O4 — CID 10944207
(3aR,4R,7aS)-4-(methoxymethoxy)-2,2,6-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole (PubChem CID 10944207) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-(methoxymethoxy)-2,2,6-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole.
| Compound Name | (3aR,4R,7aS)-4-(methoxymethoxy)-2,2,6-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 10944207 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3aR,4R,7aS)-4-(methoxymethoxy)-2,2,6-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
| SMILES | COCO[C@@H]1CC(C)=C[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H20O4/c1-8-5-9(14-7-13-4)11-10(6-8)15-12(2,3)16-11/h6,9-11H,5,7H2,1-4H3/t9-,10+,11-/m1/s1 |
| InChIKey | UPNVKALRYSDZHY-OUAUKWLOSA-N |
| XLogP | 1.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|