About 3,4-dibutoxythiophene
3,4-dibutoxythiophene (PubChem CID 10944218) has the molecular formula C12H20O2S
and a molecular weight of 228.36 g/mol. Its IUPAC name is 3,4-dibutoxythiophene.
Molecular Properties
| Compound Name | 3,4-dibutoxythiophene |
| PubChem CID | 10944218 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3,4-dibutoxythiophene |
| SMILES | CCCCOc1cscc1OCCCC |
| InChI | InChI=1S/C12H20O2S/c1-3-5-7-13-11-9-15-10-12(11)14-8-6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | XWEYATZFSPHATJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibutoxythiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibutoxythiophene?
The IUPAC name of 3,4-dibutoxythiophene (CID 10944218) is 3,4-dibutoxythiophene.
What is the SMILES notation for 3,4-dibutoxythiophene?
The canonical SMILES for 3,4-dibutoxythiophene is CCCCOc1cscc1OCCCC.
What is the InChIKey of 3,4-dibutoxythiophene?
The InChIKey is XWEYATZFSPHATJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2S/c1-3-5-7-13-11-9-15-10-12(11)14-8-6-4-2/h9-10H,3-8H2,1-2H3.
What are the key properties of 3,4-dibutoxythiophene?
3,4-dibutoxythiophene has a molecular weight of 228.36 g/mol, XLogP of 4.11, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibutoxythiophene is sourced from PubChem (CID 10944218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).