About 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one
3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one (PubChem CID 10944266) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one |
| PubChem CID | 10944266 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one |
| SMILES | COC1=CC(=O)C(C)(C)C(c2ccccc2)C1 |
| InChI | InChI=1S/C15H18O2/c1-15(2)13(11-7-5-4-6-8-11)9-12(17-3)10-14(15)16/h4-8,10,13H,9H2,1-3H3 |
| InChIKey | UXEFUXIHRYOJNE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one?
The IUPAC name of 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one (CID 10944266) is 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one.
What is the SMILES notation for 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one?
The canonical SMILES for 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one is COC1=CC(=O)C(C)(C)C(c2ccccc2)C1.
What is the InChIKey of 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one?
The InChIKey is UXEFUXIHRYOJNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2/c1-15(2)13(11-7-5-4-6-8-11)9-12(17-3)10-14(15)16/h4-8,10,13H,9H2,1-3H3.
What are the key properties of 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one?
3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one has a molecular weight of 230.31 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-6,6-dimethyl-5-phenylcyclohex-2-en-1-one is sourced from PubChem (CID 10944266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).