C10H13F3N2O — CID 10944366
(1R,5S)-3-hydroxy-8-(2,2,2-trifluoroethyl)-8-azabicyclo[3.2.1]octane-3-carbonitrile (PubChem CID 10944366) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is (1R,5S)-3-hydroxy-8-(2,2,2-trifluoroethyl)-8-azabicyclo[3.2.1]octane-3-carbonitrile.
| Compound Name | (1R,5S)-3-hydroxy-8-(2,2,2-trifluoroethyl)-8-azabicyclo[3.2.1]octane-3-carbonitrile |
|---|---|
| PubChem CID | 10944366 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (1R,5S)-3-hydroxy-8-(2,2,2-trifluoroethyl)-8-azabicyclo[3.2.1]octane-3-carbonitrile |
| SMILES | N#CC1(O)C[C@H]2CC[C@@H](C1)N2CC(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O/c11-10(12,13)6-15-7-1-2-8(15)4-9(16,3-7)5-14/h7-8,16H,1-4,6H2/t7-,8+,9? |
| InChIKey | WKFLXVYWJYJNLS-JVHMLUBASA-N |
| XLogP | 1.43 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|