C21H34IN3O2 — CID 109443748
N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide (PubChem CID 109443748) has the molecular formula C21H34IN3O2 and a molecular weight of 487.43 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109443748 |
| Molecular Formula | C21H34IN3O2 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(OC)c(OC)c1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C21H33N3O2.HI/c1-4-22-21(24-14-17-7-5-6-8-18(17)15-24)23-12-11-16-9-10-19(25-2)20(13-16)26-3;/h9-10,13,17-18H,4-8,11-12,14-15H2,1-3H3,(H,22,23);1H |
| InChIKey | DFMQUZJLPDICKK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|