C15H9N3O — CID 10944751
12-amino-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaen-10-one (PubChem CID 10944751) has the molecular formula C15H9N3O and a molecular weight of 247.26 g/mol. Its IUPAC name is 12-amino-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaen-10-one.
| Compound Name | 12-amino-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaen-10-one |
|---|---|
| PubChem CID | 10944751 |
| Molecular Formula | C15H9N3O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 12-amino-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaen-10-one |
| SMILES | NC1=CC(=O)c2nc3ccccc3c3ccnc1c23 |
| InChI | InChI=1S/C15H9N3O/c16-10-7-12(19)15-13-9(5-6-17-14(10)13)8-3-1-2-4-11(8)18-15/h1-7H,16H2 |
| InChIKey | PIBOVIRTUIQUCT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|