C15H20O3 — CID 10944785
(2R,3aS,4R,7aR)-3a,4-dimethyl-4'-methylidenespiro[1,3,4,6,7,7a-hexahydroindene-2,3'-oxolane]-2',5-dione (PubChem CID 10944785) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (2R,3aS,4R,7aR)-3a,4-dimethyl-4'-methylidenespiro[1,3,4,6,7,7a-hexahydroindene-2,3'-oxolane]-2',5-dione.
| Compound Name | (2R,3aS,4R,7aR)-3a,4-dimethyl-4'-methylidenespiro[1,3,4,6,7,7a-hexahydroindene-2,3'-oxolane]-2',5-dione |
|---|---|
| PubChem CID | 10944785 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2R,3aS,4R,7aR)-3a,4-dimethyl-4'-methylidenespiro[1,3,4,6,7,7a-hexahydroindene-2,3'-oxolane]-2',5-dione |
| SMILES | C=C1COC(=O)[C@@]12C[C@H]1CCC(=O)[C@H](C)[C@@]1(C)C2 |
| InChI | InChI=1S/C15H20O3/c1-9-7-18-13(17)15(9)6-11-4-5-12(16)10(2)14(11,3)8-15/h10-11H,1,4-8H2,2-3H3/t10-,11+,14+,15+/m0/s1 |
| InChIKey | UKZOBPLYBMYMDS-RBDSIQFVSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|