C16H24O2 — CID 10944795
(1R)-1-[(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]prop-2-yn-1-ol (PubChem CID 10944795) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1R)-1-[(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]prop-2-yn-1-ol.
| Compound Name | (1R)-1-[(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 10944795 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1R)-1-[(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]prop-2-yn-1-ol |
| SMILES | C#C[C@H](O)[C@H]1C(C)(C)CC[C@@H]2OC/C(=C\C)[C@@]21C |
| InChI | InChI=1S/C16H24O2/c1-6-11-10-18-13-8-9-15(3,4)14(12(17)7-2)16(11,13)5/h2,6,12-14,17H,8-10H2,1,3-5H3/b11-6+/t12-,13-,14-,16-/m0/s1 |
| InChIKey | NIKOTZMIKGOZKH-JFIBHDIVSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|