C19H33F3N4O3 — CID 109448057
2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 109448057) has the molecular formula C19H33F3N4O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 109448057 |
| Molecular Formula | C19H33F3N4O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C19H33F3N4O3/c1-3-23-18(24-12-17(27)25(2)14-19(20,21)22)26-9-7-15(8-10-26)29-13-16-6-4-5-11-28-16/h15-16H,3-14H2,1-2H3,(H,23,24) |
| InChIKey | QEAZANYBOLMNEE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|