About methyl 3-nonyl-1,2-oxazole-5-carboxylate
methyl 3-nonyl-1,2-oxazole-5-carboxylate (PubChem CID 10944947) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is methyl 3-nonyl-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 3-nonyl-1,2-oxazole-5-carboxylate |
| PubChem CID | 10944947 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | methyl 3-nonyl-1,2-oxazole-5-carboxylate |
| SMILES | CCCCCCCCCc1cc(C(=O)OC)on1 |
| InChI | InChI=1S/C14H23NO3/c1-3-4-5-6-7-8-9-10-12-11-13(18-15-12)14(16)17-2/h11H,3-10H2,1-2H3 |
| InChIKey | KHGSELADISSZLN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-nonyl-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-nonyl-1,2-oxazole-5-carboxylate?
The IUPAC name of methyl 3-nonyl-1,2-oxazole-5-carboxylate (CID 10944947) is methyl 3-nonyl-1,2-oxazole-5-carboxylate.
What is the SMILES notation for methyl 3-nonyl-1,2-oxazole-5-carboxylate?
The canonical SMILES for methyl 3-nonyl-1,2-oxazole-5-carboxylate is CCCCCCCCCc1cc(C(=O)OC)on1.
What is the InChIKey of methyl 3-nonyl-1,2-oxazole-5-carboxylate?
The InChIKey is KHGSELADISSZLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO3/c1-3-4-5-6-7-8-9-10-12-11-13(18-15-12)14(16)17-2/h11H,3-10H2,1-2H3.
What are the key properties of methyl 3-nonyl-1,2-oxazole-5-carboxylate?
methyl 3-nonyl-1,2-oxazole-5-carboxylate has a molecular weight of 253.34 g/mol, XLogP of 3.75, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-nonyl-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 10944947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).