About 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one
6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one (PubChem CID 10944996) has the molecular formula C10H7BrO3
and a molecular weight of 255.07 g/mol. Its IUPAC name is 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one.
Molecular Properties
| Compound Name | 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one |
| PubChem CID | 10944996 |
| Molecular Formula | C10H7BrO3 |
| Molecular Weight | 255.07 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one |
| SMILES | O=C1c2cc3c(cc2CC1Br)OCO3 |
| InChI | InChI=1S/C10H7BrO3/c11-7-1-5-2-8-9(14-4-13-8)3-6(5)10(7)12/h2-3,7H,1,4H2 |
| InChIKey | PFFIQOPSGRRQFP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.07 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one?
The IUPAC name of 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one (CID 10944996) is 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one.
What is the SMILES notation for 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one?
The canonical SMILES for 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one is O=C1c2cc3c(cc2CC1Br)OCO3.
What is the InChIKey of 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one?
The InChIKey is PFFIQOPSGRRQFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO3/c11-7-1-5-2-8-9(14-4-13-8)3-6(5)10(7)12/h2-3,7H,1,4H2.
What are the key properties of 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one?
6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one has a molecular weight of 255.07 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one is sourced from PubChem (CID 10944996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).