C12H24O2Si2 — CID 10945060
ethyl 1,2-bis(trimethylsilyl)cycloprop-2-ene-1-carboxylate (PubChem CID 10945060) has the molecular formula C12H24O2Si2 and a molecular weight of 256.49 g/mol. Its IUPAC name is ethyl 1,2-bis(trimethylsilyl)cycloprop-2-ene-1-carboxylate.
| Compound Name | ethyl 1,2-bis(trimethylsilyl)cycloprop-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 10945060 |
| Molecular Formula | C12H24O2Si2 |
| Molecular Weight | 256.49 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | ethyl 1,2-bis(trimethylsilyl)cycloprop-2-ene-1-carboxylate |
| SMILES | CCOC(=O)C1([Si](C)(C)C)C=C1[Si](C)(C)C |
| InChI | InChI=1S/C12H24O2Si2/c1-8-14-11(13)12(16(5,6)7)9-10(12)15(2,3)4/h9H,8H2,1-7H3 |
| InChIKey | YOKKPUMWWQZPHP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|