About diethyl [(1S)-1-phenylethyl] phosphate
diethyl [(1S)-1-phenylethyl] phosphate (PubChem CID 10945101) has the molecular formula C12H19O4P
and a molecular weight of 258.25 g/mol. Its IUPAC name is diethyl [(1S)-1-phenylethyl] phosphate.
Molecular Properties
| Compound Name | diethyl [(1S)-1-phenylethyl] phosphate |
| PubChem CID | 10945101 |
| Molecular Formula | C12H19O4P |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | diethyl [(1S)-1-phenylethyl] phosphate |
| SMILES | CCOP(=O)(OCC)O[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C12H19O4P/c1-4-14-17(13,15-5-2)16-11(3)12-9-7-6-8-10-12/h6-11H,4-5H2,1-3H3/t11-/m0/s1 |
| InChIKey | KEHCTXDLIGSVEI-NSHDSACASA-N |
| XLogP | 3.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl [(1S)-1-phenylethyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl [(1S)-1-phenylethyl] phosphate?
The IUPAC name of diethyl [(1S)-1-phenylethyl] phosphate (CID 10945101) is diethyl [(1S)-1-phenylethyl] phosphate.
What is the SMILES notation for diethyl [(1S)-1-phenylethyl] phosphate?
The canonical SMILES for diethyl [(1S)-1-phenylethyl] phosphate is CCOP(=O)(OCC)O[C@@H](C)c1ccccc1.
What is the InChIKey of diethyl [(1S)-1-phenylethyl] phosphate?
The InChIKey is KEHCTXDLIGSVEI-NSHDSACASA-N. The full InChI is InChI=1S/C12H19O4P/c1-4-14-17(13,15-5-2)16-11(3)12-9-7-6-8-10-12/h6-11H,4-5H2,1-3H3/t11-/m0/s1.
What are the key properties of diethyl [(1S)-1-phenylethyl] phosphate?
diethyl [(1S)-1-phenylethyl] phosphate has a molecular weight of 258.25 g/mol, XLogP of 3.95, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl [(1S)-1-phenylethyl] phosphate is sourced from PubChem (CID 10945101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).