C22H29F2IN4O3 — CID 109451686
3-[[[[[2-(difluoromethoxy)-4-propoxyphenyl]methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 109451686) has the molecular formula C22H29F2IN4O3 and a molecular weight of 562.40 g/mol. Its IUPAC name is 3-[[[[[2-(difluoromethoxy)-4-propoxyphenyl]methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | 3-[[[[[2-(difluoromethoxy)-4-propoxyphenyl]methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 109451686 |
| Molecular Formula | C22H29F2IN4O3 |
| Molecular Weight | 562.40 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 3-[[[[[2-(difluoromethoxy)-4-propoxyphenyl]methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCCOc1ccc(CN/C(=N/Cc2cccc(C(N)=O)c2)NCC)c(OC(F)F)c1.I |
| InChI | InChI=1S/C22H28F2N4O3.HI/c1-3-10-30-18-9-8-17(19(12-18)31-21(23)24)14-28-22(26-4-2)27-13-15-6-5-7-16(11-15)20(25)29;/h5-9,11-12,21H,3-4,10,13-14H2,1-2H3,(H2,25,29)(H2,26,27,28);1H |
| InChIKey | LHBXMSUUMXLSAE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|