C12H24FN3 — CID 109451729
N-(3-fluoropropyl)-N',2,2,3,3-pentamethylazetidine-1-carboximidamide (PubChem CID 109451729) has the molecular formula C12H24FN3 and a molecular weight of 229.34 g/mol. Its IUPAC name is N-(3-fluoropropyl)-N',2,2,3,3-pentamethylazetidine-1-carboximidamide.
| Compound Name | N-(3-fluoropropyl)-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109451729 |
| Molecular Formula | C12H24FN3 |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | N-(3-fluoropropyl)-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCF)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C12H24FN3/c1-11(2)9-16(12(11,3)4)10(14-5)15-8-6-7-13/h6-9H2,1-5H3,(H,14,15) |
| InChIKey | ZGBHSBTUJNHELU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|