C12H25N3O2S — CID 109451803
N',2,2,3,3-pentamethyl-N-(2-methylsulfonylethyl)azetidine-1-carboximidamide (PubChem CID 109451803) has the molecular formula C12H25N3O2S and a molecular weight of 275.42 g/mol. Its IUPAC name is N',2,2,3,3-pentamethyl-N-(2-methylsulfonylethyl)azetidine-1-carboximidamide.
| Compound Name | N',2,2,3,3-pentamethyl-N-(2-methylsulfonylethyl)azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109451803 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N',2,2,3,3-pentamethyl-N-(2-methylsulfonylethyl)azetidine-1-carboximidamide |
| SMILES | C/N=C(\NCCS(C)(=O)=O)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C12H25N3O2S/c1-11(2)9-15(12(11,3)4)10(13-5)14-7-8-18(6,16)17/h7-9H2,1-6H3,(H,13,14) |
| InChIKey | DEARLVQPBWXFFC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|