C16H34N4O2S — CID 109451981
N'-[2-(diethylsulfamoyl)ethyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide (PubChem CID 109451981) has the molecular formula C16H34N4O2S and a molecular weight of 346.54 g/mol. Its IUPAC name is N'-[2-(diethylsulfamoyl)ethyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide.
| Compound Name | N'-[2-(diethylsulfamoyl)ethyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109451981 |
| Molecular Formula | C16H34N4O2S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N'-[2-(diethylsulfamoyl)ethyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)N(CC)CC)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C16H34N4O2S/c1-8-17-14(20-13-15(4,5)16(20,6)7)18-11-12-23(21,22)19(9-2)10-3/h8-13H2,1-7H3,(H,17,18) |
| InChIKey | VHRGPKXZHFMXPG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|