C16H32N4O2S2 — CID 109451983
N-ethyl-2,2,3,3-tetramethyl-N'-(2-thiomorpholin-4-ylsulfonylethyl)azetidine-1-carboximidamide (PubChem CID 109451983) has the molecular formula C16H32N4O2S2 and a molecular weight of 376.59 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N'-(2-thiomorpholin-4-ylsulfonylethyl)azetidine-1-carboximidamide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N'-(2-thiomorpholin-4-ylsulfonylethyl)azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109451983 |
| Molecular Formula | C16H32N4O2S2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N'-(2-thiomorpholin-4-ylsulfonylethyl)azetidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)N1CCSCC1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C16H32N4O2S2/c1-6-17-14(20-13-15(2,3)16(20,4)5)18-7-12-24(21,22)19-8-10-23-11-9-19/h6-13H2,1-5H3,(H,17,18) |
| InChIKey | JXBSXBFLUUORBT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|