C16H29F3N4 — CID 109452103
N'-ethyl-2,2,3,3-tetramethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]azetidine-1-carboximidamide (PubChem CID 109452103) has the molecular formula C16H29F3N4 and a molecular weight of 334.43 g/mol. Its IUPAC name is N'-ethyl-2,2,3,3-tetramethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]azetidine-1-carboximidamide.
| Compound Name | N'-ethyl-2,2,3,3-tetramethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109452103 |
| Molecular Formula | C16H29F3N4 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | N'-ethyl-2,2,3,3-tetramethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]azetidine-1-carboximidamide |
| SMILES | CC/N=C(/NC1CCN(CC(F)(F)F)C1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C16H29F3N4/c1-6-20-13(23-10-14(2,3)15(23,4)5)21-12-7-8-22(9-12)11-16(17,18)19/h12H,6-11H2,1-5H3,(H,20,21) |
| InChIKey | CSJNXVPKDKQNQT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|