C14H29N3O2S — CID 109452151
N',2,2,3,3-pentamethyl-N-(2-methyl-2-methylsulfonylpropyl)azetidine-1-carboximidamide (PubChem CID 109452151) has the molecular formula C14H29N3O2S and a molecular weight of 303.47 g/mol. Its IUPAC name is N',2,2,3,3-pentamethyl-N-(2-methyl-2-methylsulfonylpropyl)azetidine-1-carboximidamide.
| Compound Name | N',2,2,3,3-pentamethyl-N-(2-methyl-2-methylsulfonylpropyl)azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109452151 |
| Molecular Formula | C14H29N3O2S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | N',2,2,3,3-pentamethyl-N-(2-methyl-2-methylsulfonylpropyl)azetidine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)(C)S(C)(=O)=O)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C14H29N3O2S/c1-12(2)10-17(14(12,5)6)11(15-7)16-9-13(3,4)20(8,18)19/h9-10H2,1-8H3,(H,15,16) |
| InChIKey | AHMJWZNDFORKTM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|