C16H34IN3OS — CID 109452382
N'-(2-tert-butylsulfinylethyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide (PubChem CID 109452382) has the molecular formula C16H34IN3OS and a molecular weight of 443.44 g/mol. Its IUPAC name is N'-(2-tert-butylsulfinylethyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2-tert-butylsulfinylethyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109452382 |
| Molecular Formula | C16H34IN3OS |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N'-(2-tert-butylsulfinylethyl)-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)C(C)(C)C)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C16H33N3OS.HI/c1-9-17-13(18-10-11-21(20)14(2,3)4)19-12-15(5,6)16(19,7)8;/h9-12H2,1-8H3,(H,17,18);1H |
| InChIKey | OJTIIEKFOSZQAX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|